C16H18F13I — CID 11093095
(E)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodohexadec-7-ene (PubChem CID 11093095) has the molecular formula C16H18F13I and a molecular weight of 584.20 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodohexadec-7-ene.
| Compound Name | (E)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodohexadec-7-ene |
|---|---|
| PubChem CID | 11093095 |
| Molecular Formula | C16H18F13I |
| Molecular Weight | 584.20 g/mol |
| Exact Mass | 584.02 |
| IUPAC Name | (E)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodohexadec-7-ene |
| SMILES | CCCCCCCC/C(I)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F13I/c1-2-3-4-5-6-7-8-10(30)9-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h9H,2-8H2,1H3/b10-9+ |
| InChIKey | QIGIYQIIOMZJAU-MDZDMXLPSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.20 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|