C21H13BrF17IO2 — CID 150184402
(7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-5-iodotetradec-5-enyl) 4-bromobenzoate (PubChem CID 150184402) has the molecular formula C21H13BrF17IO2 and a molecular weight of 827.11 g/mol. Its IUPAC name is (7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-5-iodotetradec-5-enyl) 4-bromobenzoate.
| Compound Name | (7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-5-iodotetradec-5-enyl) 4-bromobenzoate |
|---|---|
| PubChem CID | 150184402 |
| Molecular Formula | C21H13BrF17IO2 |
| Molecular Weight | 827.11 g/mol |
| Exact Mass | 825.89 |
| IUPAC Name | (7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-5-iodotetradec-5-enyl) 4-bromobenzoate |
| SMILES | O=C(OCCCCC(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H13BrF17IO2/c22-11-6-4-10(5-7-11)13(41)42-8-2-1-3-12(40)9-14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)21(37,38)39/h4-7,9H,1-3,8H2 |
| InChIKey | FMCHQLDKSVXEJX-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.11 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|