C12H12F11IO — CID 153324036
8,8,9,9,10,10,11,11,12,12,12-undecafluoro-6-iodododec-6-en-1-ol (PubChem CID 153324036) has the molecular formula C12H12F11IO and a molecular weight of 508.11 g/mol. Its IUPAC name is 8,8,9,9,10,10,11,11,12,12,12-undecafluoro-6-iodododec-6-en-1-ol.
| Compound Name | 8,8,9,9,10,10,11,11,12,12,12-undecafluoro-6-iodododec-6-en-1-ol |
|---|---|
| PubChem CID | 153324036 |
| Molecular Formula | C12H12F11IO |
| Molecular Weight | 508.11 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | 8,8,9,9,10,10,11,11,12,12,12-undecafluoro-6-iodododec-6-en-1-ol |
| SMILES | OCCCCCC(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F11IO/c13-8(14,6-7(24)4-2-1-3-5-25)9(15,16)10(17,18)11(19,20)12(21,22)23/h6,25H,1-5H2 |
| InChIKey | JEDWBHMWDCPYHI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.11 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|