C9H8F9IO — CID 12036415
(Z)-5,5,6,6,7,7,8,8,8-nonafluoro-3-iodo-2-methyloct-3-en-2-ol (PubChem CID 12036415) has the molecular formula C9H8F9IO and a molecular weight of 430.05 g/mol. Its IUPAC name is (Z)-5,5,6,6,7,7,8,8,8-nonafluoro-3-iodo-2-methyloct-3-en-2-ol.
| Compound Name | (Z)-5,5,6,6,7,7,8,8,8-nonafluoro-3-iodo-2-methyloct-3-en-2-ol |
|---|---|
| PubChem CID | 12036415 |
| Molecular Formula | C9H8F9IO |
| Molecular Weight | 430.05 g/mol |
| Exact Mass | 429.95 |
| IUPAC Name | (Z)-5,5,6,6,7,7,8,8,8-nonafluoro-3-iodo-2-methyloct-3-en-2-ol |
| SMILES | CC(C)(O)/C(I)=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F9IO/c1-5(2,20)4(19)3-6(10,11)7(12,13)8(14,15)9(16,17)18/h3,20H,1-2H3/b4-3- |
| InChIKey | RQUUNYKQJTVEJD-ARJAWSKDSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.05 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|