C16H14F17IO — CID 153324272
9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluoro-7-iodohexadec-7-en-1-ol (PubChem CID 153324272) has the molecular formula C16H14F17IO and a molecular weight of 672.16 g/mol. Its IUPAC name is 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluoro-7-iodohexadec-7-en-1-ol.
| Compound Name | 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluoro-7-iodohexadec-7-en-1-ol |
|---|---|
| PubChem CID | 153324272 |
| Molecular Formula | C16H14F17IO |
| Molecular Weight | 672.16 g/mol |
| Exact Mass | 671.98 |
| IUPAC Name | 9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecafluoro-7-iodohexadec-7-en-1-ol |
| SMILES | OCCCCCCC(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F17IO/c17-9(18,7-8(34)5-3-1-2-4-6-35)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h7,35H,1-6H2 |
| InChIKey | NSYFSQXTOCLSJJ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.16 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|