C19H18F9IO2 — CID 102357857
1-[4-[(E)-7,7,8,8,9,9,10,10,10-nonafluoro-5-iododec-5-enoxy]phenyl]propan-1-one (PubChem CID 102357857) has the molecular formula C19H18F9IO2 and a molecular weight of 576.24 g/mol. Its IUPAC name is 1-[4-[(E)-7,7,8,8,9,9,10,10,10-nonafluoro-5-iododec-5-enoxy]phenyl]propan-1-one.
| Compound Name | 1-[4-[(E)-7,7,8,8,9,9,10,10,10-nonafluoro-5-iododec-5-enoxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 102357857 |
| Molecular Formula | C19H18F9IO2 |
| Molecular Weight | 576.24 g/mol |
| Exact Mass | 576.02 |
| IUPAC Name | 1-[4-[(E)-7,7,8,8,9,9,10,10,10-nonafluoro-5-iododec-5-enoxy]phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(OCCCC/C(I)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F9IO2/c1-2-15(30)12-6-8-14(9-7-12)31-10-4-3-5-13(29)11-16(20,21)17(22,23)18(24,25)19(26,27)28/h6-9,11H,2-5,10H2,1H3/b13-11+ |
| InChIKey | JSAQPGAQXGWDJJ-ACCUITESSA-N |
| XLogP | 7.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.24 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|