C14H15F13O2 — CID 10095869
(E)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)hept-3-ene-1,7-diol (PubChem CID 10095869) has the molecular formula C14H15F13O2 and a molecular weight of 462.25 g/mol. Its IUPAC name is (E)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)hept-3-ene-1,7-diol.
| Compound Name | (E)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)hept-3-ene-1,7-diol |
|---|---|
| PubChem CID | 10095869 |
| Molecular Formula | C14H15F13O2 |
| Molecular Weight | 462.25 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (E)-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)hept-3-ene-1,7-diol |
| SMILES | OCC/C=C(\CCCO)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F13O2/c15-9(16,7-8(3-1-5-28)4-2-6-29)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h3,28-29H,1-2,4-7H2/b8-3+ |
| InChIKey | CLYKQYRVDNFFMR-FPYGCLRLSA-N |
| XLogP | 5.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|