C16H14F9IO2 — CID 164897946
5,5,6,6,7,7,8,8,8-nonafluoro-3-iodo-1-(4-methoxyphenyl)-2-methyloct-3-en-2-ol (PubChem CID 164897946) has the molecular formula C16H14F9IO2 and a molecular weight of 536.17 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,8-nonafluoro-3-iodo-1-(4-methoxyphenyl)-2-methyloct-3-en-2-ol.
| Compound Name | 5,5,6,6,7,7,8,8,8-nonafluoro-3-iodo-1-(4-methoxyphenyl)-2-methyloct-3-en-2-ol |
|---|---|
| PubChem CID | 164897946 |
| Molecular Formula | C16H14F9IO2 |
| Molecular Weight | 536.17 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | 5,5,6,6,7,7,8,8,8-nonafluoro-3-iodo-1-(4-methoxyphenyl)-2-methyloct-3-en-2-ol |
| SMILES | COc1ccc(CC(C)(O)C(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F9IO2/c1-12(27,7-9-3-5-10(28-2)6-4-9)11(26)8-13(17,18)14(19,20)15(21,22)16(23,24)25/h3-6,8,27H,7H2,1-2H3 |
| InChIKey | UVCRKYHHWGCCFU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.17 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|