C10H12F5I — CID 11245158
(4E)-1,1,2,3,3-pentafluoro-5-iododeca-1,4-diene (PubChem CID 11245158) has the molecular formula C10H12F5I and a molecular weight of 354.10 g/mol. Its IUPAC name is (4E)-1,1,2,3,3-pentafluoro-5-iododeca-1,4-diene.
| Compound Name | (4E)-1,1,2,3,3-pentafluoro-5-iododeca-1,4-diene |
|---|---|
| PubChem CID | 11245158 |
| Molecular Formula | C10H12F5I |
| Molecular Weight | 354.10 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | (4E)-1,1,2,3,3-pentafluoro-5-iododeca-1,4-diene |
| SMILES | CCCCC/C(I)=C\C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C10H12F5I/c1-2-3-4-5-7(16)6-10(14,15)8(11)9(12)13/h6H,2-5H2,1H3/b7-6+ |
| InChIKey | XEKHZHFHERHCGN-VOTSOKGWSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.10 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|