C12H17F7 — CID 154155860
1,1,2,3,3,4,4-heptafluorododec-1-ene (PubChem CID 154155860) has the molecular formula C12H17F7 and a molecular weight of 294.25 g/mol. Its IUPAC name is 1,1,2,3,3,4,4-heptafluorododec-1-ene.
| Compound Name | 1,1,2,3,3,4,4-heptafluorododec-1-ene |
|---|---|
| PubChem CID | 154155860 |
| Molecular Formula | C12H17F7 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1,1,2,3,3,4,4-heptafluorododec-1-ene |
| SMILES | CCCCCCCCC(F)(F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C12H17F7/c1-2-3-4-5-6-7-8-11(16,17)12(18,19)9(13)10(14)15/h2-8H2,1H3 |
| InChIKey | APTQRTRIQMWAMI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|