C14H25F5O2 — CID 166650292
6,6,7,8,8-pentafluoro-7-hydroperoxytetradecane (PubChem CID 166650292) has the molecular formula C14H25F5O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is 6,6,7,8,8-pentafluoro-7-hydroperoxytetradecane.
| Compound Name | 6,6,7,8,8-pentafluoro-7-hydroperoxytetradecane |
|---|---|
| PubChem CID | 166650292 |
| Molecular Formula | C14H25F5O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 6,6,7,8,8-pentafluoro-7-hydroperoxytetradecane |
| SMILES | CCCCCCC(F)(F)C(F)(OO)C(F)(F)CCCCC |
| InChI | InChI=1S/C14H25F5O2/c1-3-5-7-9-11-13(17,18)14(19,21-20)12(15,16)10-8-6-4-2/h20H,3-11H2,1-2H3 |
| InChIKey | BZQGJOGUVVMDHN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|