C8H13Cl3F4Si — CID 102098431
trichloro(1,1,2,2-tetrafluorooctyl)silane (PubChem CID 102098431) has the molecular formula C8H13Cl3F4Si and a molecular weight of 319.63 g/mol. Its IUPAC name is trichloro(1,1,2,2-tetrafluorooctyl)silane.
| Compound Name | trichloro(1,1,2,2-tetrafluorooctyl)silane |
|---|---|
| PubChem CID | 102098431 |
| Molecular Formula | C8H13Cl3F4Si |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | trichloro(1,1,2,2-tetrafluorooctyl)silane |
| SMILES | CCCCCCC(F)(F)C(F)(F)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C8H13Cl3F4Si/c1-2-3-4-5-6-7(12,13)8(14,15)16(9,10)11/h2-6H2,1H3 |
| InChIKey | MAIVIPURIYEQCP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|