C11H17Cl2F7Si — CID 141014947
dichloro-(1,1,2,2,10,10,10-heptafluorodecyl)-methylsilane (PubChem CID 141014947) has the molecular formula C11H17Cl2F7Si and a molecular weight of 381.24 g/mol. Its IUPAC name is dichloro-(1,1,2,2,10,10,10-heptafluorodecyl)-methylsilane.
| Compound Name | dichloro-(1,1,2,2,10,10,10-heptafluorodecyl)-methylsilane |
|---|---|
| PubChem CID | 141014947 |
| Molecular Formula | C11H17Cl2F7Si |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | dichloro-(1,1,2,2,10,10,10-heptafluorodecyl)-methylsilane |
| SMILES | C[Si](Cl)(Cl)C(F)(F)C(F)(F)CCCCCCCC(F)(F)F |
| InChI | InChI=1S/C11H17Cl2F7Si/c1-21(12,13)11(19,20)9(14,15)7-5-3-2-4-6-8-10(16,17)18/h2-8H2,1H3 |
| InChIKey | XHOVNESHIUPHIC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|