C14H25F7O4Si — CID 141120987
3-(1,1,2,2,8,8,8-heptafluorooctoxy)propyl-trimethoxysilane (PubChem CID 141120987) has the molecular formula C14H25F7O4Si and a molecular weight of 418.42 g/mol. Its IUPAC name is 3-(1,1,2,2,8,8,8-heptafluorooctoxy)propyl-trimethoxysilane.
| Compound Name | 3-(1,1,2,2,8,8,8-heptafluorooctoxy)propyl-trimethoxysilane |
|---|---|
| PubChem CID | 141120987 |
| Molecular Formula | C14H25F7O4Si |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-(1,1,2,2,8,8,8-heptafluorooctoxy)propyl-trimethoxysilane |
| SMILES | CO[Si](CCCOC(F)(F)C(F)(F)CCCCCC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C14H25F7O4Si/c1-22-26(23-2,24-3)11-7-10-25-14(20,21)12(15,16)8-5-4-6-9-13(17,18)19/h4-11H2,1-3H3 |
| InChIKey | RPNDTHRKKJUVJE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|