C11H21F5O3Si — CID 141376252
trimethoxy(1,1,8,8,8-pentafluorooctyl)silane (PubChem CID 141376252) has the molecular formula C11H21F5O3Si and a molecular weight of 324.36 g/mol. Its IUPAC name is trimethoxy(1,1,8,8,8-pentafluorooctyl)silane.
| Compound Name | trimethoxy(1,1,8,8,8-pentafluorooctyl)silane |
|---|---|
| PubChem CID | 141376252 |
| Molecular Formula | C11H21F5O3Si |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | trimethoxy(1,1,8,8,8-pentafluorooctyl)silane |
| SMILES | CO[Si](OC)(OC)C(F)(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C11H21F5O3Si/c1-17-20(18-2,19-3)11(15,16)9-7-5-4-6-8-10(12,13)14/h4-9H2,1-3H3 |
| InChIKey | DIKMBICBNSXOKI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|