C16H19F17O3Si — CID 75201310
1,1-difluorodecyl-tris(1,1,2,2,2-pentafluoroethoxy)silane (PubChem CID 75201310) has the molecular formula C16H19F17O3Si and a molecular weight of 610.38 g/mol. Its IUPAC name is 1,1-difluorodecyl-tris(1,1,2,2,2-pentafluoroethoxy)silane.
| Compound Name | 1,1-difluorodecyl-tris(1,1,2,2,2-pentafluoroethoxy)silane |
|---|---|
| PubChem CID | 75201310 |
| Molecular Formula | C16H19F17O3Si |
| Molecular Weight | 610.38 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | 1,1-difluorodecyl-tris(1,1,2,2,2-pentafluoroethoxy)silane |
| SMILES | CCCCCCCCCC(F)(F)[Si](OC(F)(F)C(F)(F)F)(OC(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H19F17O3Si/c1-2-3-4-5-6-7-8-9-10(17,18)37(34-14(28,29)11(19,20)21,35-15(30,31)12(22,23)24)36-16(32,33)13(25,26)27/h2-9H2,1H3 |
| InChIKey | XJKCJJXLDZMBPG-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.38 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|