C19H22F18 — CID 150550335
1,1,1-trifluoro-3,3-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-(trifluoromethyl)dodecane (PubChem CID 150550335) has the molecular formula C19H22F18 and a molecular weight of 592.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-3,3-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-(trifluoromethyl)dodecane.
| Compound Name | 1,1,1-trifluoro-3,3-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-(trifluoromethyl)dodecane |
|---|---|
| PubChem CID | 150550335 |
| Molecular Formula | C19H22F18 |
| Molecular Weight | 592.35 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 1,1,1-trifluoro-3,3-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-(trifluoromethyl)dodecane |
| SMILES | CCCCCCCCCC(C(C(F)(F)F)C(F)(F)F)(C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H22F18/c1-2-3-4-5-6-7-8-9-13(10(14(20,21)22)15(23,24)25,11(16(26,27)28)17(29,30)31)12(18(32,33)34)19(35,36)37/h10-12H,2-9H2,1H3 |
| InChIKey | IHSVODCRPATGEE-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.35 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|