C16H29F7O3Si — CID 175214480
decyl-(1,1-difluoroethoxy)-ethoxy-(1,1,2,2,2-pentafluoroethoxy)silane (PubChem CID 175214480) has the molecular formula C16H29F7O3Si and a molecular weight of 430.48 g/mol. Its IUPAC name is decyl-(1,1-difluoroethoxy)-ethoxy-(1,1,2,2,2-pentafluoroethoxy)silane.
| Compound Name | decyl-(1,1-difluoroethoxy)-ethoxy-(1,1,2,2,2-pentafluoroethoxy)silane |
|---|---|
| PubChem CID | 175214480 |
| Molecular Formula | C16H29F7O3Si |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | decyl-(1,1-difluoroethoxy)-ethoxy-(1,1,2,2,2-pentafluoroethoxy)silane |
| SMILES | CCCCCCCCCC[Si](OCC)(OC(C)(F)F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H29F7O3Si/c1-4-6-7-8-9-10-11-12-13-27(24-5-2,25-14(3,17)18)26-16(22,23)15(19,20)21/h4-13H2,1-3H3 |
| InChIKey | QFYZOVZCKBUCJH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|