C12H22F6O3Si — CID 174971084
ethoxy-(1-fluoroethoxy)-hexyl-(1,1,2,2,2-pentafluoroethoxy)silane (PubChem CID 174971084) has the molecular formula C12H22F6O3Si and a molecular weight of 356.38 g/mol. Its IUPAC name is ethoxy-(1-fluoroethoxy)-hexyl-(1,1,2,2,2-pentafluoroethoxy)silane.
| Compound Name | ethoxy-(1-fluoroethoxy)-hexyl-(1,1,2,2,2-pentafluoroethoxy)silane |
|---|---|
| PubChem CID | 174971084 |
| Molecular Formula | C12H22F6O3Si |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | ethoxy-(1-fluoroethoxy)-hexyl-(1,1,2,2,2-pentafluoroethoxy)silane |
| SMILES | CCCCCC[Si](OCC)(OC(C)F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H22F6O3Si/c1-4-6-7-8-9-22(19-5-2,20-10(3)13)21-12(17,18)11(14,15)16/h10H,4-9H2,1-3H3 |
| InChIKey | SOTCBKCLSDLTJP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|