C10H21F3O3Si — CID 174718643
diethoxy-methoxy-(5,5,5-trifluoropentyl)silane (PubChem CID 174718643) has the molecular formula C10H21F3O3Si and a molecular weight of 274.35 g/mol. Its IUPAC name is diethoxy-methoxy-(5,5,5-trifluoropentyl)silane.
| Compound Name | diethoxy-methoxy-(5,5,5-trifluoropentyl)silane |
|---|---|
| PubChem CID | 174718643 |
| Molecular Formula | C10H21F3O3Si |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | diethoxy-methoxy-(5,5,5-trifluoropentyl)silane |
| SMILES | CCO[Si](CCCCC(F)(F)F)(OC)OCC |
| InChI | InChI=1S/C10H21F3O3Si/c1-4-15-17(14-3,16-5-2)9-7-6-8-10(11,12)13/h4-9H2,1-3H3 |
| InChIKey | MPTMWXOSCKAYSW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|