C11H21F3O3S — CID 150831281
methyl 10,10,10-trifluorodecane-1-sulfonate (PubChem CID 150831281) has the molecular formula C11H21F3O3S and a molecular weight of 290.35 g/mol. Its IUPAC name is methyl 10,10,10-trifluorodecane-1-sulfonate.
| Compound Name | methyl 10,10,10-trifluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 150831281 |
| Molecular Formula | C11H21F3O3S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | methyl 10,10,10-trifluorodecane-1-sulfonate |
| SMILES | COS(=O)(=O)CCCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3O3S/c1-17-18(15,16)10-8-6-4-2-3-5-7-9-11(12,13)14/h2-10H2,1H3 |
| InChIKey | KLZZTYPNUCPAII-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|