About azane;9,9,9-trifluorononane-1-sulfonic acid
azane;9,9,9-trifluorononane-1-sulfonic acid (PubChem CID 171929032) has the molecular formula C9H20F3NO3S
and a molecular weight of 279.32 g/mol. Its IUPAC name is azane;9,9,9-trifluorononane-1-sulfonic acid.
Molecular Properties
| Compound Name | azane;9,9,9-trifluorononane-1-sulfonic acid |
| PubChem CID | 171929032 |
| Molecular Formula | C9H20F3NO3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | azane;9,9,9-trifluorononane-1-sulfonic acid |
| SMILES | N.O=S(=O)(O)CCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C9H17F3O3S.H3N/c10-9(11,12)7-5-3-1-2-4-6-8-16(13,14)15;/h1-8H2,(H,13,14,15);1H3 |
| InChIKey | UEJFVLKBWMUODK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;9,9,9-trifluorononane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;9,9,9-trifluorononane-1-sulfonic acid?
The IUPAC name of azane;9,9,9-trifluorononane-1-sulfonic acid (CID 171929032) is azane;9,9,9-trifluorononane-1-sulfonic acid.
What is the SMILES notation for azane;9,9,9-trifluorononane-1-sulfonic acid?
The canonical SMILES for azane;9,9,9-trifluorononane-1-sulfonic acid is N.O=S(=O)(O)CCCCCCCCC(F)(F)F.
What is the InChIKey of azane;9,9,9-trifluorononane-1-sulfonic acid?
The InChIKey is UEJFVLKBWMUODK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3O3S.H3N/c10-9(11,12)7-5-3-1-2-4-6-8-16(13,14)15;/h1-8H2,(H,13,14,15);1H3.
What are the key properties of azane;9,9,9-trifluorononane-1-sulfonic acid?
azane;9,9,9-trifluorononane-1-sulfonic acid has a molecular weight of 279.32 g/mol, XLogP of 3.33, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;9,9,9-trifluorononane-1-sulfonic acid is sourced from PubChem (CID 171929032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).