C9H14F6O3S — CID 142684707
7,7,7-trifluoro-6-methyl-6-(trifluoromethyl)heptane-1-sulfonic acid (PubChem CID 142684707) has the molecular formula C9H14F6O3S and a molecular weight of 316.26 g/mol. Its IUPAC name is 7,7,7-trifluoro-6-methyl-6-(trifluoromethyl)heptane-1-sulfonic acid.
| Compound Name | 7,7,7-trifluoro-6-methyl-6-(trifluoromethyl)heptane-1-sulfonic acid |
|---|---|
| PubChem CID | 142684707 |
| Molecular Formula | C9H14F6O3S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 7,7,7-trifluoro-6-methyl-6-(trifluoromethyl)heptane-1-sulfonic acid |
| SMILES | CC(CCCCCS(=O)(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6O3S/c1-7(8(10,11)12,9(13,14)15)5-3-2-4-6-19(16,17)18/h2-6H2,1H3,(H,16,17,18) |
| InChIKey | XEDLLYHHPBUEAJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|