C29H36F3O3PS — CID 162621565
(4-methylphenyl)-diphenylphosphane;10,10,10-trifluorodecane-1-sulfonic acid (PubChem CID 162621565) has the molecular formula C29H36F3O3PS and a molecular weight of 552.64 g/mol. Its IUPAC name is (4-methylphenyl)-diphenylphosphane;10,10,10-trifluorodecane-1-sulfonic acid.
| Compound Name | (4-methylphenyl)-diphenylphosphane;10,10,10-trifluorodecane-1-sulfonic acid |
|---|---|
| PubChem CID | 162621565 |
| Molecular Formula | C29H36F3O3PS |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | (4-methylphenyl)-diphenylphosphane;10,10,10-trifluorodecane-1-sulfonic acid |
| SMILES | Cc1ccc(P(c2ccccc2)c2ccccc2)cc1.O=S(=O)(O)CCCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C19H17P.C10H19F3O3S/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;11-10(12,13)8-6-4-2-1-3-5-7-9-17(14,15)16/h2-15H,1H3;1-9H2,(H,14,15,16) |
| InChIKey | UYESDRMPFDFVTD-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|