C15H21F3O3S — CID 58052812
5,5-dimethyl-6-[2-(trifluoromethyl)phenyl]hexane-1-sulfonic acid (PubChem CID 58052812) has the molecular formula C15H21F3O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is 5,5-dimethyl-6-[2-(trifluoromethyl)phenyl]hexane-1-sulfonic acid.
| Compound Name | 5,5-dimethyl-6-[2-(trifluoromethyl)phenyl]hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58052812 |
| Molecular Formula | C15H21F3O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5,5-dimethyl-6-[2-(trifluoromethyl)phenyl]hexane-1-sulfonic acid |
| SMILES | CC(C)(CCCCS(=O)(=O)O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3O3S/c1-14(2,9-5-6-10-22(19,20)21)11-12-7-3-4-8-13(12)15(16,17)18/h3-4,7-8H,5-6,9-11H2,1-2H3,(H,19,20,21) |
| InChIKey | BAVLCHAILVEQMO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|