C8H7F3O3S — CID 86065127
[2-(trifluoromethyl)phenyl]methanesulfonic acid (PubChem CID 86065127) has the molecular formula C8H7F3O3S and a molecular weight of 240.20 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl]methanesulfonic acid.
| Compound Name | [2-(trifluoromethyl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 86065127 |
| Molecular Formula | C8H7F3O3S |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methanesulfonic acid |
| SMILES | O=S(=O)(O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C8H7F3O3S/c9-8(10,11)7-4-2-1-3-6(7)5-15(12,13)14/h1-4H,5H2,(H,12,13,14) |
| InChIKey | KUCRAQDBLZUBQD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|