C7H9NNaO3S — CID 87855006
CID 87855006 (PubChem CID 87855006) has the molecular formula C7H9NNaO3S and a molecular weight of 210.21 g/mol.
| Compound Name | CID 87855006 |
|---|---|
| PubChem CID | 87855006 |
| Molecular Formula | C7H9NNaO3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | — |
| SMILES | Nc1ccccc1CS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C7H9NO3S.Na/c8-7-4-2-1-3-6(7)5-12(9,10)11;/h1-4H,5,8H2,(H,9,10,11); |
| InChIKey | HEVIXIMKHRCECT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|