C10H11F3O3S — CID 159838378
ethyl [2-(trifluoromethyl)phenyl]methanesulfonate (PubChem CID 159838378) has the molecular formula C10H11F3O3S and a molecular weight of 268.26 g/mol. Its IUPAC name is ethyl [2-(trifluoromethyl)phenyl]methanesulfonate.
| Compound Name | ethyl [2-(trifluoromethyl)phenyl]methanesulfonate |
|---|---|
| PubChem CID | 159838378 |
| Molecular Formula | C10H11F3O3S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | ethyl [2-(trifluoromethyl)phenyl]methanesulfonate |
| SMILES | CCOS(=O)(=O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3O3S/c1-2-16-17(14,15)7-8-5-3-4-6-9(8)10(11,12)13/h3-6H,2,7H2,1H3 |
| InChIKey | UWMWDSZOGLPQHR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|