C15H10F3NO2S2 — CID 102052715
2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]-1,3-benzothiazole (PubChem CID 102052715) has the molecular formula C15H10F3NO2S2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]-1,3-benzothiazole.
| Compound Name | 2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 102052715 |
| Molecular Formula | C15H10F3NO2S2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]-1,3-benzothiazole |
| SMILES | O=S(=O)(Cc1ccccc1C(F)(F)F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10F3NO2S2/c16-15(17,18)11-6-2-1-5-10(11)9-23(20,21)14-19-12-7-3-4-8-13(12)22-14/h1-8H,9H2 |
| InChIKey | UWKMAMYNDCYMMP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |