C33H24N4O2S2 — CID 139720343
2-[(4-trityl-2H-benzotriazol-5-yl)methylsulfonyl]-1,3-benzothiazole (PubChem CID 139720343) has the molecular formula C33H24N4O2S2 and a molecular weight of 572.72 g/mol. Its IUPAC name is 2-[(4-trityl-2H-benzotriazol-5-yl)methylsulfonyl]-1,3-benzothiazole.
| Compound Name | 2-[(4-trityl-2H-benzotriazol-5-yl)methylsulfonyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 139720343 |
| Molecular Formula | C33H24N4O2S2 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 2-[(4-trityl-2H-benzotriazol-5-yl)methylsulfonyl]-1,3-benzothiazole |
| SMILES | O=S(=O)(Cc1ccc2n[nH]nc2c1C(c1ccccc1)(c1ccccc1)c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C33H24N4O2S2/c38-41(39,32-34-27-18-10-11-19-29(27)40-32)22-23-20-21-28-31(36-37-35-28)30(23)33(24-12-4-1-5-13-24,25-14-6-2-7-15-25)26-16-8-3-9-17-26/h1-21H,22H2,(H,35,36,37) |
| InChIKey | XTEQZILVIILFER-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|