C13H11N3O2S2 — CID 165097232
2-[(5-methylpyrimidin-2-yl)methylsulfonyl]-1,3-benzothiazole (PubChem CID 165097232) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[(5-methylpyrimidin-2-yl)methylsulfonyl]-1,3-benzothiazole.
| Compound Name | 2-[(5-methylpyrimidin-2-yl)methylsulfonyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 165097232 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-[(5-methylpyrimidin-2-yl)methylsulfonyl]-1,3-benzothiazole |
| SMILES | Cc1cnc(CS(=O)(=O)c2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C13H11N3O2S2/c1-9-6-14-12(15-7-9)8-20(17,18)13-16-10-4-2-3-5-11(10)19-13/h2-7H,8H2,1H3 |
| InChIKey | XSDKSVKBKZWYPM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |