C10H9NO2S2 — CID 701066
2-prop-2-enylsulfonyl-1,3-benzothiazole (PubChem CID 701066) has the molecular formula C10H9NO2S2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-prop-2-enylsulfonyl-1,3-benzothiazole.
| Compound Name | 2-prop-2-enylsulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 701066 |
| Molecular Formula | C10H9NO2S2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 2-prop-2-enylsulfonyl-1,3-benzothiazole |
| SMILES | C=CCS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H9NO2S2/c1-2-7-15(12,13)10-11-8-5-3-4-6-9(8)14-10/h2-6H,1,7H2 |
| InChIKey | LLETVIRFTRIQGN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|