C12H13FN2O2S2 — CID 44604973
N-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]prop-2-en-1-amine (PubChem CID 44604973) has the molecular formula C12H13FN2O2S2 and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]prop-2-en-1-amine.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 44604973 |
| Molecular Formula | C12H13FN2O2S2 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]prop-2-en-1-amine |
| SMILES | C=CCNCC(F)S(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13FN2O2S2/c1-2-7-14-8-11(13)19(16,17)12-15-9-5-3-4-6-10(9)18-12/h2-6,11,14H,1,7-8H2 |
| InChIKey | KFYWXGYBYKGNKR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|