About 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine
4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine (PubChem CID 44604971) has the molecular formula C13H15FN2O3S2
and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine |
| PubChem CID | 44604971 |
| Molecular Formula | C13H15FN2O3S2 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine |
| SMILES | O=S(=O)(c1nc2ccccc2s1)C(F)CN1CCOCC1 |
| InChI | InChI=1S/C13H15FN2O3S2/c14-12(9-16-5-7-19-8-6-16)21(17,18)13-15-10-3-1-2-4-11(10)20-13/h1-4,12H,5-9H2 |
| InChIKey | DJXOYIPGHSSLDS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine?
The IUPAC name of 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine (CID 44604971) is 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine.
What is the SMILES notation for 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine?
The canonical SMILES for 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine is O=S(=O)(c1nc2ccccc2s1)C(F)CN1CCOCC1.
What is the InChIKey of 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine?
The InChIKey is DJXOYIPGHSSLDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O3S2/c14-12(9-16-5-7-19-8-6-16)21(17,18)13-15-10-3-1-2-4-11(10)20-13/h1-4,12H,5-9H2.
What are the key properties of 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine?
4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine has a molecular weight of 330.41 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine is sourced from PubChem (CID 44604971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).