C13H15FN2O3S2 — CID 44604971
4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine (PubChem CID 44604971) has the molecular formula C13H15FN2O3S2 and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine.
| Compound Name | 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine |
|---|---|
| PubChem CID | 44604971 |
| Molecular Formula | C13H15FN2O3S2 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-[2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoroethyl]morpholine |
| SMILES | O=S(=O)(c1nc2ccccc2s1)C(F)CN1CCOCC1 |
| InChI | InChI=1S/C13H15FN2O3S2/c14-12(9-16-5-7-19-8-6-16)21(17,18)13-15-10-3-1-2-4-11(10)20-13/h1-4,12H,5-9H2 |
| InChIKey | DJXOYIPGHSSLDS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |