C15H10FNO3S2 — CID 42646384
2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoro-1-phenylethanone (PubChem CID 42646384) has the molecular formula C15H10FNO3S2 and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoro-1-phenylethanone.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoro-1-phenylethanone |
|---|---|
| PubChem CID | 42646384 |
| Molecular Formula | C15H10FNO3S2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfonyl)-2-fluoro-1-phenylethanone |
| SMILES | O=C(c1ccccc1)C(F)S(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10FNO3S2/c16-14(13(18)10-6-2-1-3-7-10)22(19,20)15-17-11-8-4-5-9-12(11)21-15/h1-9,14H |
| InChIKey | QBIGGOYWVLFBGL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |