C7H6KNO4S2 — CID 44726049
potassium;1,3-benzothiazole-2-sulfonate;hydrate (PubChem CID 44726049) has the molecular formula C7H6KNO4S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is potassium;1,3-benzothiazole-2-sulfonate;hydrate.
| Compound Name | potassium;1,3-benzothiazole-2-sulfonate;hydrate |
|---|---|
| PubChem CID | 44726049 |
| Molecular Formula | C7H6KNO4S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | potassium;1,3-benzothiazole-2-sulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])c1nc2ccccc2s1.[K+] |
| InChI | InChI=1S/C7H5NO3S2.K.H2O/c9-13(10,11)7-8-5-3-1-2-4-6(5)12-7;;/h1-4H,(H,9,10,11);;1H2/q;+1;/p-1 |
| InChIKey | QOQPMLXKRCUHLA-UHFFFAOYSA-M |
| XLogP | -2.62 |
| TPSA | 101.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|