C12H13NO3S2 — CID 46177813
(E)-5-(1,3-benzothiazol-2-ylsulfonyl)pent-2-en-1-ol (PubChem CID 46177813) has the molecular formula C12H13NO3S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (E)-5-(1,3-benzothiazol-2-ylsulfonyl)pent-2-en-1-ol.
| Compound Name | (E)-5-(1,3-benzothiazol-2-ylsulfonyl)pent-2-en-1-ol |
|---|---|
| PubChem CID | 46177813 |
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | (E)-5-(1,3-benzothiazol-2-ylsulfonyl)pent-2-en-1-ol |
| SMILES | O=S(=O)(CC/C=C/CO)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NO3S2/c14-8-4-1-5-9-18(15,16)12-13-10-6-2-3-7-11(10)17-12/h1-4,6-7,14H,5,8-9H2/b4-1+ |
| InChIKey | ZGEQGTULEOEYAQ-DAFODLJHSA-N |
| XLogP | 2.01 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|