C16H19NO2S2 — CID 102367589
2-(3,3-dimethylhept-5-ynylsulfonyl)-1,3-benzothiazole (PubChem CID 102367589) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-(3,3-dimethylhept-5-ynylsulfonyl)-1,3-benzothiazole.
| Compound Name | 2-(3,3-dimethylhept-5-ynylsulfonyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 102367589 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-(3,3-dimethylhept-5-ynylsulfonyl)-1,3-benzothiazole |
| SMILES | CC#CCC(C)(C)CCS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H19NO2S2/c1-4-5-10-16(2,3)11-12-21(18,19)15-17-13-8-6-7-9-14(13)20-15/h6-9H,10-12H2,1-3H3 |
| InChIKey | DBVYGJACSDLTFJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|