C13H14N2O2S3 — CID 144623676
ethane;2-(1,3-thiazol-2-ylmethylsulfonyl)-1,3-benzothiazole (PubChem CID 144623676) has the molecular formula C13H14N2O2S3 and a molecular weight of 326.47 g/mol. Its IUPAC name is ethane;2-(1,3-thiazol-2-ylmethylsulfonyl)-1,3-benzothiazole.
| Compound Name | ethane;2-(1,3-thiazol-2-ylmethylsulfonyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 144623676 |
| Molecular Formula | C13H14N2O2S3 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | ethane;2-(1,3-thiazol-2-ylmethylsulfonyl)-1,3-benzothiazole |
| SMILES | CC.O=S(=O)(Cc1nccs1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H8N2O2S3.C2H6/c14-18(15,7-10-12-5-6-16-10)11-13-8-3-1-2-4-9(8)17-11;1-2/h1-6H,7H2;1-2H3 |
| InChIKey | JPTIMZYKZAQXFO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |