C27H31NO3S2Si — CID 11827319
[(2S)-3-(1,3-benzothiazol-2-ylsulfonyl)-2-methylpropoxy]-tert-butyl-diphenylsilane (PubChem CID 11827319) has the molecular formula C27H31NO3S2Si and a molecular weight of 509.77 g/mol. Its IUPAC name is [(2S)-3-(1,3-benzothiazol-2-ylsulfonyl)-2-methylpropoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2S)-3-(1,3-benzothiazol-2-ylsulfonyl)-2-methylpropoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11827319 |
| Molecular Formula | C27H31NO3S2Si |
| Molecular Weight | 509.77 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | [(2S)-3-(1,3-benzothiazol-2-ylsulfonyl)-2-methylpropoxy]-tert-butyl-diphenylsilane |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C27H31NO3S2Si/c1-21(20-33(29,30)26-28-24-17-11-12-18-25(24)32-26)19-31-34(27(2,3)4,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-18,21H,19-20H2,1-4H3/t21-/m0/s1 |
| InChIKey | FTPSYFXWTLOGGM-NRFANRHFSA-N |
| XLogP | 5.28 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|