C26H43NO4S2Si — CID 640706
[(E,2R,3S,4S,8S)-9-(1,3-benzothiazol-2-ylsulfonyl)-3-methoxy-4,6,8-trimethylnon-5-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 640706) has the molecular formula C26H43NO4S2Si and a molecular weight of 525.85 g/mol. Its IUPAC name is [(E,2R,3S,4S,8S)-9-(1,3-benzothiazol-2-ylsulfonyl)-3-methoxy-4,6,8-trimethylnon-5-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E,2R,3S,4S,8S)-9-(1,3-benzothiazol-2-ylsulfonyl)-3-methoxy-4,6,8-trimethylnon-5-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 640706 |
| Molecular Formula | C26H43NO4S2Si |
| Molecular Weight | 525.85 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | [(E,2R,3S,4S,8S)-9-(1,3-benzothiazol-2-ylsulfonyl)-3-methoxy-4,6,8-trimethylnon-5-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H]([C@@H](C)/C=C(\C)C[C@H](C)CS(=O)(=O)c1nc2ccccc2s1)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H43NO4S2Si/c1-18(16-20(3)24(30-8)21(4)31-34(9,10)26(5,6)7)15-19(2)17-33(28,29)25-27-22-13-11-12-14-23(22)32-25/h11-14,16,19-21,24H,15,17H2,1-10H3/b18-16+/t19-,20-,21+,24-/m0/s1 |
| InChIKey | KJWAUKJZAYDFPM-SCCSGHHCSA-N |
| XLogP | 7.10 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.85 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|