C27H39NO3S2Si — CID 102518306
[(2E,4Z,8Z,11Z)-1-(1,3-benzothiazol-2-ylsulfonyl)tetradeca-2,4,8,11-tetraen-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102518306) has the molecular formula C27H39NO3S2Si and a molecular weight of 517.83 g/mol. Its IUPAC name is [(2E,4Z,8Z,11Z)-1-(1,3-benzothiazol-2-ylsulfonyl)tetradeca-2,4,8,11-tetraen-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2E,4Z,8Z,11Z)-1-(1,3-benzothiazol-2-ylsulfonyl)tetradeca-2,4,8,11-tetraen-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102518306 |
| Molecular Formula | C27H39NO3S2Si |
| Molecular Weight | 517.83 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | [(2E,4Z,8Z,11Z)-1-(1,3-benzothiazol-2-ylsulfonyl)tetradeca-2,4,8,11-tetraen-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC/C=C\C/C=C\CC(/C=C\C=C\CS(=O)(=O)c1nc2ccccc2s1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H39NO3S2Si/c1-7-8-9-10-11-13-18-23(31-34(5,6)27(2,3)4)19-14-12-17-22-33(29,30)26-28-24-20-15-16-21-25(24)32-26/h8-9,11-17,19-21,23H,7,10,18,22H2,1-6H3/b9-8-,13-11-,17-12+,19-14- |
| InChIKey | KDKJFXQEKSYFDL-PSKHNEGQSA-N |
| XLogP | 7.88 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.83 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|