C27H39NO4S2Si — CID 50915696
[(3S,4S)-6-(1,3-benzothiazol-2-ylsulfonyl)-4-methyl-1-phenylmethoxyhexan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 50915696) has the molecular formula C27H39NO4S2Si and a molecular weight of 533.83 g/mol. Its IUPAC name is [(3S,4S)-6-(1,3-benzothiazol-2-ylsulfonyl)-4-methyl-1-phenylmethoxyhexan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,4S)-6-(1,3-benzothiazol-2-ylsulfonyl)-4-methyl-1-phenylmethoxyhexan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 50915696 |
| Molecular Formula | C27H39NO4S2Si |
| Molecular Weight | 533.83 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | [(3S,4S)-6-(1,3-benzothiazol-2-ylsulfonyl)-4-methyl-1-phenylmethoxyhexan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](CCS(=O)(=O)c1nc2ccccc2s1)[C@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H39NO4S2Si/c1-21(17-19-34(29,30)26-28-23-14-10-11-15-25(23)33-26)24(32-35(5,6)27(2,3)4)16-18-31-20-22-12-8-7-9-13-22/h7-15,21,24H,16-20H2,1-6H3/t21-,24-/m0/s1 |
| InChIKey | DRSRQMFPIQYNOW-URXFXBBRSA-N |
| XLogP | 7.09 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.83 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|