C25H45F3O4Si2 — CID 139682000
(2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,1,1-trifluoro-6-phenylmethoxyhexan-2-ol (PubChem CID 139682000) has the molecular formula C25H45F3O4Si2 and a molecular weight of 522.80 g/mol. Its IUPAC name is (2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,1,1-trifluoro-6-phenylmethoxyhexan-2-ol.
| Compound Name | (2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,1,1-trifluoro-6-phenylmethoxyhexan-2-ol |
|---|---|
| PubChem CID | 139682000 |
| Molecular Formula | C25H45F3O4Si2 |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | (2S,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1,1,1-trifluoro-6-phenylmethoxyhexan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]([C@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C)[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C25H45F3O4Si2/c1-23(2,3)33(7,8)31-20(16-17-30-18-19-14-12-11-13-15-19)21(22(29)25(26,27)28)32-34(9,10)24(4,5)6/h11-15,20-22,29H,16-18H2,1-10H3/t20-,21+,22-/m0/s1 |
| InChIKey | USYACRZWUAPYRD-BDTNDASRSA-N |
| XLogP | 7.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|