C22H25NO3S2 — CID 102124095
2-[(E,4S,5S)-5-methoxy-2,4-dimethyl-6-phenylhex-2-enyl]sulfonyl-1,3-benzothiazole (PubChem CID 102124095) has the molecular formula C22H25NO3S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 2-[(E,4S,5S)-5-methoxy-2,4-dimethyl-6-phenylhex-2-enyl]sulfonyl-1,3-benzothiazole.
| Compound Name | 2-[(E,4S,5S)-5-methoxy-2,4-dimethyl-6-phenylhex-2-enyl]sulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 102124095 |
| Molecular Formula | C22H25NO3S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[(E,4S,5S)-5-methoxy-2,4-dimethyl-6-phenylhex-2-enyl]sulfonyl-1,3-benzothiazole |
| SMILES | CO[C@@H](Cc1ccccc1)[C@@H](C)/C=C(\C)CS(=O)(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H25NO3S2/c1-16(13-17(2)20(26-3)14-18-9-5-4-6-10-18)15-28(24,25)22-23-19-11-7-8-12-21(19)27-22/h4-13,17,20H,14-15H2,1-3H3/b16-13+/t17-,20-/m0/s1 |
| InChIKey | LBGVFVZCUPDHRT-AWZJPIPXSA-N |
| XLogP | 4.91 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|