C27H31O2P — CID 102124094
[(E,2S,3S)-6-diphenylphosphoryl-2-methoxy-3,5-dimethylhex-4-enyl]benzene (PubChem CID 102124094) has the molecular formula C27H31O2P and a molecular weight of 418.52 g/mol. Its IUPAC name is [(E,2S,3S)-6-diphenylphosphoryl-2-methoxy-3,5-dimethylhex-4-enyl]benzene.
| Compound Name | [(E,2S,3S)-6-diphenylphosphoryl-2-methoxy-3,5-dimethylhex-4-enyl]benzene |
|---|---|
| PubChem CID | 102124094 |
| Molecular Formula | C27H31O2P |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(E,2S,3S)-6-diphenylphosphoryl-2-methoxy-3,5-dimethylhex-4-enyl]benzene |
| SMILES | CO[C@@H](Cc1ccccc1)[C@@H](C)/C=C(\C)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31O2P/c1-22(19-23(2)27(29-3)20-24-13-7-4-8-14-24)21-30(28,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-19,23,27H,20-21H2,1-3H3/b22-19+/t23-,27-/m0/s1 |
| InChIKey | CXUBQMITIGKCOJ-ZWNQWHRTSA-N |
| XLogP | 5.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|