C14H18O — CID 10821998
[(2S,3S)-2-methoxy-3-methylhex-4-ynyl]benzene (PubChem CID 10821998) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is [(2S,3S)-2-methoxy-3-methylhex-4-ynyl]benzene.
| Compound Name | [(2S,3S)-2-methoxy-3-methylhex-4-ynyl]benzene |
|---|---|
| PubChem CID | 10821998 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | [(2S,3S)-2-methoxy-3-methylhex-4-ynyl]benzene |
| SMILES | CC#C[C@H](C)[C@H](Cc1ccccc1)OC |
| InChI | InChI=1S/C14H18O/c1-4-8-12(2)14(15-3)11-13-9-6-5-7-10-13/h5-7,9-10,12,14H,11H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | BAQOUUZXFLGOFZ-JSGCOSHPSA-N |
| XLogP | 2.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|