C11H16O3 — CID 139743448
3-methoxy-4-phenylbutane-1,2-diol (PubChem CID 139743448) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-methoxy-4-phenylbutane-1,2-diol.
| Compound Name | 3-methoxy-4-phenylbutane-1,2-diol |
|---|---|
| PubChem CID | 139743448 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-methoxy-4-phenylbutane-1,2-diol |
| SMILES | COC(Cc1ccccc1)C(O)CO |
| InChI | InChI=1S/C11H16O3/c1-14-11(10(13)8-12)7-9-5-3-2-4-6-9/h2-6,10-13H,7-8H2,1H3 |
| InChIKey | UQRGLYFGUKXMHL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |