C21H24O6 — CID 54250401
(3R,6S)-2,3,6-trihydroxy-7-methoxy-1,8-diphenyloctane-4,5-dione (PubChem CID 54250401) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3R,6S)-2,3,6-trihydroxy-7-methoxy-1,8-diphenyloctane-4,5-dione.
| Compound Name | (3R,6S)-2,3,6-trihydroxy-7-methoxy-1,8-diphenyloctane-4,5-dione |
|---|---|
| PubChem CID | 54250401 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (3R,6S)-2,3,6-trihydroxy-7-methoxy-1,8-diphenyloctane-4,5-dione |
| SMILES | COC(Cc1ccccc1)[C@H](O)C(=O)C(=O)[C@H](O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H24O6/c1-27-17(13-15-10-6-3-7-11-15)19(24)21(26)20(25)18(23)16(22)12-14-8-4-2-5-9-14/h2-11,16-19,22-24H,12-13H2,1H3/t16?,17?,18-,19+/m1/s1 |
| InChIKey | QWIHZYGPWKUCHY-GMNCBBECSA-N |
| XLogP | 0.71 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|