C19H19ClO5 — CID 54060479
(5R)-1-(4-chlorophenyl)-2,5,6-trihydroxy-7-phenylheptane-3,4-dione (PubChem CID 54060479) has the molecular formula C19H19ClO5 and a molecular weight of 362.81 g/mol. Its IUPAC name is (5R)-1-(4-chlorophenyl)-2,5,6-trihydroxy-7-phenylheptane-3,4-dione.
| Compound Name | (5R)-1-(4-chlorophenyl)-2,5,6-trihydroxy-7-phenylheptane-3,4-dione |
|---|---|
| PubChem CID | 54060479 |
| Molecular Formula | C19H19ClO5 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (5R)-1-(4-chlorophenyl)-2,5,6-trihydroxy-7-phenylheptane-3,4-dione |
| SMILES | O=C(C(=O)[C@H](O)C(O)Cc1ccccc1)C(O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClO5/c20-14-8-6-13(7-9-14)11-16(22)18(24)19(25)17(23)15(21)10-12-4-2-1-3-5-12/h1-9,15-17,21-23H,10-11H2/t15?,16?,17-/m1/s1 |
| InChIKey | LZIXMEAISDOTHB-OFLPRAFFSA-N |
| XLogP | 1.35 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|